C17H26F3N3O4 — CID 152662040
(2R,3R,4S)-3-acetamido-N,N-dipropyl-4-[(3,3,3-trifluoro-2-oxopropyl)amino]-3,4-dihydro-2H-pyran-2-carboxamide (PubChem CID 152662040) has the molecular formula C17H26F3N3O4 and a molecular weight of 393.41 g/mol. Its IUPAC name is (2R,3R,4S)-3-acetamido-N,N-dipropyl-4-[(3,3,3-trifluoro-2-oxopropyl)amino]-3,4-dihydro-2H-pyran-2-carboxamide.
| Compound Name | (2R,3R,4S)-3-acetamido-N,N-dipropyl-4-[(3,3,3-trifluoro-2-oxopropyl)amino]-3,4-dihydro-2H-pyran-2-carboxamide |
|---|---|
| PubChem CID | 152662040 |
| Molecular Formula | C17H26F3N3O4 |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | (2R,3R,4S)-3-acetamido-N,N-dipropyl-4-[(3,3,3-trifluoro-2-oxopropyl)amino]-3,4-dihydro-2H-pyran-2-carboxamide |
| SMILES | CCCN(CCC)C(=O)[C@@H]1OC=C[C@H](NCC(=O)C(F)(F)F)[C@H]1NC(C)=O |
| InChI | InChI=1S/C17H26F3N3O4/c1-4-7-23(8-5-2)16(26)15-14(22-11(3)24)12(6-9-27-15)21-10-13(25)17(18,19)20/h6,9,12,14-15,21H,4-5,7-8,10H2,1-3H3,(H,22,24)/t12-,14+,15+/m0/s1 |
| InChIKey | ZJTFRDHOISEQOJ-NWANDNLSSA-N |
| XLogP | 1.14 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |