C13H21NO4 — CID 15266437
(4,4-dimethyl-2,6-dioxopiperidin-1-yl)methyl 2,2-dimethylpropanoate (PubChem CID 15266437) has the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. Its IUPAC name is (4,4-dimethyl-2,6-dioxopiperidin-1-yl)methyl 2,2-dimethylpropanoate.
| Compound Name | (4,4-dimethyl-2,6-dioxopiperidin-1-yl)methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 15266437 |
| Molecular Formula | C13H21NO4 |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | (4,4-dimethyl-2,6-dioxopiperidin-1-yl)methyl 2,2-dimethylpropanoate |
| SMILES | CC1(C)CC(=O)N(COC(=O)C(C)(C)C)C(=O)C1 |
| InChI | InChI=1S/C13H21NO4/c1-12(2,3)11(17)18-8-14-9(15)6-13(4,5)7-10(14)16/h6-8H2,1-5H3 |
| InChIKey | PKDONJZIOLDLNZ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|