About 1-(1,4-dimethoxycyclohexa-2,4-dien-1-yl)pyrrolidine
1-(1,4-dimethoxycyclohexa-2,4-dien-1-yl)pyrrolidine (PubChem CID 152665926) has the molecular formula C12H19NO2
and a molecular weight of 209.29 g/mol. Its IUPAC name is 1-(1,4-dimethoxycyclohexa-2,4-dien-1-yl)pyrrolidine.
Molecular Properties
| Compound Name | 1-(1,4-dimethoxycyclohexa-2,4-dien-1-yl)pyrrolidine |
| PubChem CID | 152665926 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 1-(1,4-dimethoxycyclohexa-2,4-dien-1-yl)pyrrolidine |
| SMILES | COC1=CCC(OC)(N2CCCC2)C=C1 |
| InChI | InChI=1S/C12H19NO2/c1-14-11-5-7-12(15-2,8-6-11)13-9-3-4-10-13/h5-7H,3-4,8-10H2,1-2H3 |
| InChIKey | ZKMVTJMPWFDOJI-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(1,4-dimethoxycyclohexa-2,4-dien-1-yl)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,4-dimethoxycyclohexa-2,4-dien-1-yl)pyrrolidine?
The IUPAC name of 1-(1,4-dimethoxycyclohexa-2,4-dien-1-yl)pyrrolidine (CID 152665926) is 1-(1,4-dimethoxycyclohexa-2,4-dien-1-yl)pyrrolidine.
What is the SMILES notation for 1-(1,4-dimethoxycyclohexa-2,4-dien-1-yl)pyrrolidine?
The canonical SMILES for 1-(1,4-dimethoxycyclohexa-2,4-dien-1-yl)pyrrolidine is COC1=CCC(OC)(N2CCCC2)C=C1.
What is the InChIKey of 1-(1,4-dimethoxycyclohexa-2,4-dien-1-yl)pyrrolidine?
The InChIKey is ZKMVTJMPWFDOJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO2/c1-14-11-5-7-12(15-2,8-6-11)13-9-3-4-10-13/h5-7H,3-4,8-10H2,1-2H3.
What are the key properties of 1-(1,4-dimethoxycyclohexa-2,4-dien-1-yl)pyrrolidine?
1-(1,4-dimethoxycyclohexa-2,4-dien-1-yl)pyrrolidine has a molecular weight of 209.29 g/mol, XLogP of 1.92, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,4-dimethoxycyclohexa-2,4-dien-1-yl)pyrrolidine is sourced from PubChem (CID 152665926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).