C9H8Cl2F8 — CID 152666773
1,8-dichloro-2,3,3,4,4-pentafluoro-5-(trifluoromethyl)oct-1-ene (PubChem CID 152666773) has the molecular formula C9H8Cl2F8 and a molecular weight of 339.05 g/mol. Its IUPAC name is 1,8-dichloro-2,3,3,4,4-pentafluoro-5-(trifluoromethyl)oct-1-ene.
| Compound Name | 1,8-dichloro-2,3,3,4,4-pentafluoro-5-(trifluoromethyl)oct-1-ene |
|---|---|
| PubChem CID | 152666773 |
| Molecular Formula | C9H8Cl2F8 |
| Molecular Weight | 339.05 g/mol |
| Exact Mass | 337.99 |
| IUPAC Name | 1,8-dichloro-2,3,3,4,4-pentafluoro-5-(trifluoromethyl)oct-1-ene |
| SMILES | FC(=CCl)C(F)(F)C(F)(F)C(CCCCl)C(F)(F)F |
| InChI | InChI=1S/C9H8Cl2F8/c10-3-1-2-5(9(17,18)19)7(13,14)8(15,16)6(12)4-11/h4-5H,1-3H2 |
| InChIKey | ZKRFRERNOALEJA-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.05 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|