C26H44FN5O4Si — CID 152668809
tert-butyl N-[(3S,5S)-1-[5-amino-7-fluoro-1-(2-methoxyethyl)indazol-4-yl]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrrolidin-3-yl]carbamate (PubChem CID 152668809) has the molecular formula C26H44FN5O4Si and a molecular weight of 537.75 g/mol. Its IUPAC name is tert-butyl N-[(3S,5S)-1-[5-amino-7-fluoro-1-(2-methoxyethyl)indazol-4-yl]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,5S)-1-[5-amino-7-fluoro-1-(2-methoxyethyl)indazol-4-yl]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 152668809 |
| Molecular Formula | C26H44FN5O4Si |
| Molecular Weight | 537.75 g/mol |
| Exact Mass | 537.31 |
| IUPAC Name | tert-butyl N-[(3S,5S)-1-[5-amino-7-fluoro-1-(2-methoxyethyl)indazol-4-yl]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrrolidin-3-yl]carbamate |
| SMILES | COCCn1ncc2c(N3C[C@@H](NC(=O)OC(C)(C)C)C[C@H]3CO[Si](C)(C)C(C)(C)C)c(N)cc(F)c21 |
| InChI | InChI=1S/C26H44FN5O4Si/c1-25(2,3)36-24(33)30-17-12-18(16-35-37(8,9)26(4,5)6)31(15-17)23-19-14-29-32(10-11-34-7)22(19)20(27)13-21(23)28/h13-14,17-18H,10-12,15-16,28H2,1-9H3,(H,30,33)/t17-,18-/m0/s1 |
| InChIKey | ZLBUZXRMMVTUGA-ROUUACIJSA-N |
| XLogP | 4.90 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.75 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|