C38H40F3NO4S — CID 152673207
[2-oxo-8-phenyl-1-[(4-phenylphenyl)methyl]-3,4-dihydroquinolin-5-yl] 10,10,10-trifluorodecane-1-sulfonate (PubChem CID 152673207) has the molecular formula C38H40F3NO4S and a molecular weight of 663.80 g/mol. Its IUPAC name is [2-oxo-8-phenyl-1-[(4-phenylphenyl)methyl]-3,4-dihydroquinolin-5-yl] 10,10,10-trifluorodecane-1-sulfonate.
| Compound Name | [2-oxo-8-phenyl-1-[(4-phenylphenyl)methyl]-3,4-dihydroquinolin-5-yl] 10,10,10-trifluorodecane-1-sulfonate |
|---|---|
| PubChem CID | 152673207 |
| Molecular Formula | C38H40F3NO4S |
| Molecular Weight | 663.80 g/mol |
| Exact Mass | 663.26 |
| IUPAC Name | [2-oxo-8-phenyl-1-[(4-phenylphenyl)methyl]-3,4-dihydroquinolin-5-yl] 10,10,10-trifluorodecane-1-sulfonate |
| SMILES | O=C1CCc2c(OS(=O)(=O)CCCCCCCCCC(F)(F)F)ccc(-c3ccccc3)c2N1Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C38H40F3NO4S/c39-38(40,41)26-12-4-2-1-3-5-13-27-47(44,45)46-35-24-22-33(32-16-10-7-11-17-32)37-34(35)23-25-36(43)42(37)28-29-18-20-31(21-19-29)30-14-8-6-9-15-30/h6-11,14-22,24H,1-5,12-13,23,25-28H2 |
| InChIKey | ZLZDTZIDVPHAPE-UHFFFAOYSA-N |
| XLogP | 9.89 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.80 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|