C17H16O2 — CID 15267343
4-phenyltricyclo[6.2.1.02,7]undeca-2,4,6-triene-3,6-diol (PubChem CID 15267343) has the molecular formula C17H16O2 and a molecular weight of 252.31 g/mol. Its IUPAC name is 4-phenyltricyclo[6.2.1.02,7]undeca-2,4,6-triene-3,6-diol.
| Compound Name | 4-phenyltricyclo[6.2.1.02,7]undeca-2,4,6-triene-3,6-diol |
|---|---|
| PubChem CID | 15267343 |
| Molecular Formula | C17H16O2 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 4-phenyltricyclo[6.2.1.02,7]undeca-2,4,6-triene-3,6-diol |
| SMILES | Oc1cc(-c2ccccc2)c(O)c2c1C1CCC2C1 |
| InChI | InChI=1S/C17H16O2/c18-14-9-13(10-4-2-1-3-5-10)17(19)16-12-7-6-11(8-12)15(14)16/h1-5,9,11-12,18-19H,6-8H2 |
| InChIKey | TYHDUCSLVKMQTJ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|