C23H25NO5 — CID 15267626
methyl (1R,11bR)-9,10-dimethoxy-4-oxo-2-phenyl-1,2,3,6,7,11b-hexahydrobenzo[a]quinolizine-1-carboxylate (PubChem CID 15267626) has the molecular formula C23H25NO5 and a molecular weight of 395.46 g/mol. Its IUPAC name is methyl (1R,11bR)-9,10-dimethoxy-4-oxo-2-phenyl-1,2,3,6,7,11b-hexahydrobenzo[a]quinolizine-1-carboxylate.
| Compound Name | methyl (1R,11bR)-9,10-dimethoxy-4-oxo-2-phenyl-1,2,3,6,7,11b-hexahydrobenzo[a]quinolizine-1-carboxylate |
|---|---|
| PubChem CID | 15267626 |
| Molecular Formula | C23H25NO5 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | methyl (1R,11bR)-9,10-dimethoxy-4-oxo-2-phenyl-1,2,3,6,7,11b-hexahydrobenzo[a]quinolizine-1-carboxylate |
| SMILES | COC(=O)[C@@H]1C(c2ccccc2)CC(=O)N2CCc3cc(OC)c(OC)cc3[C@@H]12 |
| InChI | InChI=1S/C23H25NO5/c1-27-18-11-15-9-10-24-20(25)13-16(14-7-5-4-6-8-14)21(23(26)29-3)22(24)17(15)12-19(18)28-2/h4-8,11-12,16,21-22H,9-10,13H2,1-3H3/t16?,21-,22+/m1/s1 |
| InChIKey | GCPBDHXASZKBSG-JLYBBMSXSA-N |
| XLogP | 3.11 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |