C21H46O3Si2 — CID 152677832
(1R,3R,4S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-tri(propan-2-yl)silyloxycyclopentan-1-ol (PubChem CID 152677832) has the molecular formula C21H46O3Si2 and a molecular weight of 402.77 g/mol. Its IUPAC name is (1R,3R,4S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-tri(propan-2-yl)silyloxycyclopentan-1-ol.
| Compound Name | (1R,3R,4S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-tri(propan-2-yl)silyloxycyclopentan-1-ol |
|---|---|
| PubChem CID | 152677832 |
| Molecular Formula | C21H46O3Si2 |
| Molecular Weight | 402.77 g/mol |
| Exact Mass | 402.30 |
| IUPAC Name | (1R,3R,4S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-tri(propan-2-yl)silyloxycyclopentan-1-ol |
| SMILES | CC(C)[Si](O[C@H]1C[C@H](O)C[C@@H]1CO[Si](C)(C)C(C)(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C21H46O3Si2/c1-15(2)26(16(3)4,17(5)6)24-20-13-19(22)12-18(20)14-23-25(10,11)21(7,8)9/h15-20,22H,12-14H2,1-11H3/t18-,19-,20+/m1/s1 |
| InChIKey | ZMWWWEAWGSRGQZ-AQNXPRMDSA-N |
| XLogP | 6.34 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.77 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|