C5H9N5O2 — CID 15268101
6-hydrazinyl-2,4-dimethyl-1,2,4-triazine-3,5-dione (PubChem CID 15268101) has the molecular formula C5H9N5O2 and a molecular weight of 171.16 g/mol. Its IUPAC name is 6-hydrazinyl-2,4-dimethyl-1,2,4-triazine-3,5-dione.
| Compound Name | 6-hydrazinyl-2,4-dimethyl-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 15268101 |
| Molecular Formula | C5H9N5O2 |
| Molecular Weight | 171.16 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | 6-hydrazinyl-2,4-dimethyl-1,2,4-triazine-3,5-dione |
| SMILES | Cn1nc(NN)c(=O)n(C)c1=O |
| InChI | InChI=1S/C5H9N5O2/c1-9-4(11)3(7-6)8-10(2)5(9)12/h6H2,1-2H3,(H,7,8) |
| InChIKey | MLEVAFOVOOWHAK-UHFFFAOYSA-N |
| XLogP | -2.24 |
| TPSA | 94.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.16 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|