About 1,5-ditert-butyl-6-methylidene-3-phenylcyclohexa-1,4-diene
1,5-ditert-butyl-6-methylidene-3-phenylcyclohexa-1,4-diene (PubChem CID 152681707) has the molecular formula C21H28
and a molecular weight of 280.45 g/mol. Its IUPAC name is 1,5-ditert-butyl-6-methylidene-3-phenylcyclohexa-1,4-diene.
Molecular Properties
| Compound Name | 1,5-ditert-butyl-6-methylidene-3-phenylcyclohexa-1,4-diene |
| PubChem CID | 152681707 |
| Molecular Formula | C21H28 |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | 1,5-ditert-butyl-6-methylidene-3-phenylcyclohexa-1,4-diene |
| SMILES | C=C1C(C(C)(C)C)=CC(c2ccccc2)C=C1C(C)(C)C |
| InChI | InChI=1S/C21H28/c1-15-18(20(2,3)4)13-17(14-19(15)21(5,6)7)16-11-9-8-10-12-16/h8-14,17H,1H2,2-7H3 |
| InChIKey | ZNRLSVFUZWIBME-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,5-ditert-butyl-6-methylidene-3-phenylcyclohexa-1,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-ditert-butyl-6-methylidene-3-phenylcyclohexa-1,4-diene?
The IUPAC name of 1,5-ditert-butyl-6-methylidene-3-phenylcyclohexa-1,4-diene (CID 152681707) is 1,5-ditert-butyl-6-methylidene-3-phenylcyclohexa-1,4-diene.
What is the SMILES notation for 1,5-ditert-butyl-6-methylidene-3-phenylcyclohexa-1,4-diene?
The canonical SMILES for 1,5-ditert-butyl-6-methylidene-3-phenylcyclohexa-1,4-diene is C=C1C(C(C)(C)C)=CC(c2ccccc2)C=C1C(C)(C)C.
What is the InChIKey of 1,5-ditert-butyl-6-methylidene-3-phenylcyclohexa-1,4-diene?
The InChIKey is ZNRLSVFUZWIBME-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28/c1-15-18(20(2,3)4)13-17(14-19(15)21(5,6)7)16-11-9-8-10-12-16/h8-14,17H,1H2,2-7H3.
What are the key properties of 1,5-ditert-butyl-6-methylidene-3-phenylcyclohexa-1,4-diene?
1,5-ditert-butyl-6-methylidene-3-phenylcyclohexa-1,4-diene has a molecular weight of 280.45 g/mol, XLogP of 6.28, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-ditert-butyl-6-methylidene-3-phenylcyclohexa-1,4-diene is sourced from PubChem (CID 152681707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).