C19H17Cl2N5O3 — CID 152685456
1-(2,6-dichlorophenyl)-3-[6-(3,5-dimethoxyanilino)pyrimidin-4-yl]urea (PubChem CID 152685456) has the molecular formula C19H17Cl2N5O3 and a molecular weight of 434.28 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-3-[6-(3,5-dimethoxyanilino)pyrimidin-4-yl]urea.
| Compound Name | 1-(2,6-dichlorophenyl)-3-[6-(3,5-dimethoxyanilino)pyrimidin-4-yl]urea |
|---|---|
| PubChem CID | 152685456 |
| Molecular Formula | C19H17Cl2N5O3 |
| Molecular Weight | 434.28 g/mol |
| Exact Mass | 433.07 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-3-[6-(3,5-dimethoxyanilino)pyrimidin-4-yl]urea |
| SMILES | COc1cc(Nc2cc(NC(=O)Nc3c(Cl)cccc3Cl)ncn2)cc(OC)c1 |
| InChI | InChI=1S/C19H17Cl2N5O3/c1-28-12-6-11(7-13(8-12)29-2)24-16-9-17(23-10-22-16)25-19(27)26-18-14(20)4-3-5-15(18)21/h3-10H,1-2H3,(H3,22,23,24,25,26,27) |
| InChIKey | ZOLGXEOLIHKKHY-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 97.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.28 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |