About ethyl 1-butyl-4-(2,2-difluoroethenyl)pyrrolidine-2-carboxylate
ethyl 1-butyl-4-(2,2-difluoroethenyl)pyrrolidine-2-carboxylate (PubChem CID 152686010) has the molecular formula C13H21F2NO2
and a molecular weight of 261.31 g/mol. Its IUPAC name is ethyl 1-butyl-4-(2,2-difluoroethenyl)pyrrolidine-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-butyl-4-(2,2-difluoroethenyl)pyrrolidine-2-carboxylate |
| PubChem CID | 152686010 |
| Molecular Formula | C13H21F2NO2 |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | ethyl 1-butyl-4-(2,2-difluoroethenyl)pyrrolidine-2-carboxylate |
| SMILES | CCCCN1CC(C=C(F)F)CC1C(=O)OCC |
| InChI | InChI=1S/C13H21F2NO2/c1-3-5-6-16-9-10(8-12(14)15)7-11(16)13(17)18-4-2/h8,10-11H,3-7,9H2,1-2H3 |
| InChIKey | ZOOMMCWSMKHHPJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 1-butyl-4-(2,2-difluoroethenyl)pyrrolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-butyl-4-(2,2-difluoroethenyl)pyrrolidine-2-carboxylate?
The IUPAC name of ethyl 1-butyl-4-(2,2-difluoroethenyl)pyrrolidine-2-carboxylate (CID 152686010) is ethyl 1-butyl-4-(2,2-difluoroethenyl)pyrrolidine-2-carboxylate.
What is the SMILES notation for ethyl 1-butyl-4-(2,2-difluoroethenyl)pyrrolidine-2-carboxylate?
The canonical SMILES for ethyl 1-butyl-4-(2,2-difluoroethenyl)pyrrolidine-2-carboxylate is CCCCN1CC(C=C(F)F)CC1C(=O)OCC.
What is the InChIKey of ethyl 1-butyl-4-(2,2-difluoroethenyl)pyrrolidine-2-carboxylate?
The InChIKey is ZOOMMCWSMKHHPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21F2NO2/c1-3-5-6-16-9-10(8-12(14)15)7-11(16)13(17)18-4-2/h8,10-11H,3-7,9H2,1-2H3.
What are the key properties of ethyl 1-butyl-4-(2,2-difluoroethenyl)pyrrolidine-2-carboxylate?
ethyl 1-butyl-4-(2,2-difluoroethenyl)pyrrolidine-2-carboxylate has a molecular weight of 261.31 g/mol, XLogP of 2.82, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-butyl-4-(2,2-difluoroethenyl)pyrrolidine-2-carboxylate is sourced from PubChem (CID 152686010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).