About methyl 2-cyano-2-(4-methylsulfanyl-6-phenyl-1,3,5-triazin-2-yl)acetate
methyl 2-cyano-2-(4-methylsulfanyl-6-phenyl-1,3,5-triazin-2-yl)acetate (PubChem CID 15268762) has the molecular formula C14H12N4O2S
and a molecular weight of 300.34 g/mol. Its IUPAC name is methyl 2-cyano-2-(4-methylsulfanyl-6-phenyl-1,3,5-triazin-2-yl)acetate.
Molecular Properties
| Compound Name | methyl 2-cyano-2-(4-methylsulfanyl-6-phenyl-1,3,5-triazin-2-yl)acetate |
| PubChem CID | 15268762 |
| Molecular Formula | C14H12N4O2S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | methyl 2-cyano-2-(4-methylsulfanyl-6-phenyl-1,3,5-triazin-2-yl)acetate |
| SMILES | COC(=O)C(C#N)c1nc(SC)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C14H12N4O2S/c1-20-13(19)10(8-15)12-16-11(17-14(18-12)21-2)9-6-4-3-5-7-9/h3-7,10H,1-2H3 |
| InChIKey | SSCAFLSLRAOQKF-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 88.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 2-cyano-2-(4-methylsulfanyl-6-phenyl-1,3,5-triazin-2-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-cyano-2-(4-methylsulfanyl-6-phenyl-1,3,5-triazin-2-yl)acetate?
The IUPAC name of methyl 2-cyano-2-(4-methylsulfanyl-6-phenyl-1,3,5-triazin-2-yl)acetate (CID 15268762) is methyl 2-cyano-2-(4-methylsulfanyl-6-phenyl-1,3,5-triazin-2-yl)acetate.
What is the SMILES notation for methyl 2-cyano-2-(4-methylsulfanyl-6-phenyl-1,3,5-triazin-2-yl)acetate?
The canonical SMILES for methyl 2-cyano-2-(4-methylsulfanyl-6-phenyl-1,3,5-triazin-2-yl)acetate is COC(=O)C(C#N)c1nc(SC)nc(-c2ccccc2)n1.
What is the InChIKey of methyl 2-cyano-2-(4-methylsulfanyl-6-phenyl-1,3,5-triazin-2-yl)acetate?
The InChIKey is SSCAFLSLRAOQKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N4O2S/c1-20-13(19)10(8-15)12-16-11(17-14(18-12)21-2)9-6-4-3-5-7-9/h3-7,10H,1-2H3.
What are the key properties of methyl 2-cyano-2-(4-methylsulfanyl-6-phenyl-1,3,5-triazin-2-yl)acetate?
methyl 2-cyano-2-(4-methylsulfanyl-6-phenyl-1,3,5-triazin-2-yl)acetate has a molecular weight of 300.34 g/mol, XLogP of 2.04, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-cyano-2-(4-methylsulfanyl-6-phenyl-1,3,5-triazin-2-yl)acetate is sourced from PubChem (CID 15268762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).