2-ethoxypropanoic acid

C5H10O3 — CID 15268841

IUPAC2-ethoxypropanoic acid
SMILESCCOC(C)C(=O)O
InChIInChI=1S/C5H10O3/c1-3-8-4(2)5(6)7/h4H,3H2,1-2H3,(H,6,7)
InChIKeyXBHQOMRKOUANQQ-UHFFFAOYSA-N
MW118.13 g/mol
LogP0.50
Rot. Bonds3

About 2-ethoxypropanoic acid

2-ethoxypropanoic acid (PubChem CID 15268841) has the molecular formula C5H10O3 and a molecular weight of 118.13 g/mol. Its IUPAC name is 2-ethoxypropanoic acid.

Molecular Properties

Compound Name2-ethoxypropanoic acid
PubChem CID15268841
Molecular FormulaC5H10O3
Molecular Weight118.13 g/mol
Exact Mass118.06
IUPAC Name2-ethoxypropanoic acid
SMILESCCOC(C)C(=O)O
InChIInChI=1S/C5H10O3/c1-3-8-4(2)5(6)7/h4H,3H2,1-2H3,(H,6,7)
InChIKeyXBHQOMRKOUANQQ-UHFFFAOYSA-N
XLogP0.50
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms8
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500118.13
LogP ≤ 50.50
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-ethoxypropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-ethoxypropanoic acid?
The IUPAC name of 2-ethoxypropanoic acid (CID 15268841) is 2-ethoxypropanoic acid.
What is the SMILES notation for 2-ethoxypropanoic acid?
The canonical SMILES for 2-ethoxypropanoic acid is CCOC(C)C(=O)O.
What is the InChIKey of 2-ethoxypropanoic acid?
The InChIKey is XBHQOMRKOUANQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O3/c1-3-8-4(2)5(6)7/h4H,3H2,1-2H3,(H,6,7).
What are the key properties of 2-ethoxypropanoic acid?
2-ethoxypropanoic acid has a molecular weight of 118.13 g/mol, XLogP of 0.50, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxypropanoic acid is sourced from PubChem (CID 15268841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).