C17H26BFN2O2 — CID 152690668
2-[3-fluoro-4-[[(2R)-2-methylpyrrolidin-1-yl]methyl]phenyl]-6-methyl-1,3,6,2-dioxazaborocane (PubChem CID 152690668) has the molecular formula C17H26BFN2O2 and a molecular weight of 320.22 g/mol. Its IUPAC name is 2-[3-fluoro-4-[[(2R)-2-methylpyrrolidin-1-yl]methyl]phenyl]-6-methyl-1,3,6,2-dioxazaborocane.
| Compound Name | 2-[3-fluoro-4-[[(2R)-2-methylpyrrolidin-1-yl]methyl]phenyl]-6-methyl-1,3,6,2-dioxazaborocane |
|---|---|
| PubChem CID | 152690668 |
| Molecular Formula | C17H26BFN2O2 |
| Molecular Weight | 320.22 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | 2-[3-fluoro-4-[[(2R)-2-methylpyrrolidin-1-yl]methyl]phenyl]-6-methyl-1,3,6,2-dioxazaborocane |
| SMILES | C[C@@H]1CCCN1Cc1ccc(B2OCCN(C)CCO2)cc1F |
| InChI | InChI=1S/C17H26BFN2O2/c1-14-4-3-7-21(14)13-15-5-6-16(12-17(15)19)18-22-10-8-20(2)9-11-23-18/h5-6,12,14H,3-4,7-11,13H2,1-2H3/t14-/m1/s1 |
| InChIKey | ZPMKKNLMAOJBIN-CQSZACIVSA-N |
| XLogP | 1.48 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.22 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|