About 1,2-diazaspiro[4.5]decane-1,8-dicarboxylic acid
1,2-diazaspiro[4.5]decane-1,8-dicarboxylic acid (PubChem CID 152694765) has the molecular formula C10H16N2O4
and a molecular weight of 228.25 g/mol. Its IUPAC name is 1,2-diazaspiro[4.5]decane-1,8-dicarboxylic acid.
Molecular Properties
| Compound Name | 1,2-diazaspiro[4.5]decane-1,8-dicarboxylic acid |
| PubChem CID | 152694765 |
| Molecular Formula | C10H16N2O4 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 1,2-diazaspiro[4.5]decane-1,8-dicarboxylic acid |
| SMILES | O=C(O)C1CCC2(CCNN2C(=O)O)CC1 |
| InChI | InChI=1S/C10H16N2O4/c13-8(14)7-1-3-10(4-2-7)5-6-11-12(10)9(15)16/h7,11H,1-6H2,(H,13,14)(H,15,16) |
| InChIKey | ZQHVNBZNCQUSMS-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,2-diazaspiro[4.5]decane-1,8-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-diazaspiro[4.5]decane-1,8-dicarboxylic acid?
The IUPAC name of 1,2-diazaspiro[4.5]decane-1,8-dicarboxylic acid (CID 152694765) is 1,2-diazaspiro[4.5]decane-1,8-dicarboxylic acid.
What is the SMILES notation for 1,2-diazaspiro[4.5]decane-1,8-dicarboxylic acid?
The canonical SMILES for 1,2-diazaspiro[4.5]decane-1,8-dicarboxylic acid is O=C(O)C1CCC2(CCNN2C(=O)O)CC1.
What is the InChIKey of 1,2-diazaspiro[4.5]decane-1,8-dicarboxylic acid?
The InChIKey is ZQHVNBZNCQUSMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O4/c13-8(14)7-1-3-10(4-2-7)5-6-11-12(10)9(15)16/h7,11H,1-6H2,(H,13,14)(H,15,16).
What are the key properties of 1,2-diazaspiro[4.5]decane-1,8-dicarboxylic acid?
1,2-diazaspiro[4.5]decane-1,8-dicarboxylic acid has a molecular weight of 228.25 g/mol, XLogP of 0.89, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-diazaspiro[4.5]decane-1,8-dicarboxylic acid is sourced from PubChem (CID 152694765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).