1,2-diazaspiro[4.5]decane-1,8-dicarboxylic acid

C10H16N2O4 — CID 152694765

IUPAC1,2-diazaspiro[4.5]decane-1,8-dicarboxylic acid
SMILESO=C(O)C1CCC2(CCNN2C(=O)O)CC1
InChIInChI=1S/C10H16N2O4/c13-8(14)7-1-3-10(4-2-7)5-6-11-12(10)9(15)16/h7,11H,1-6H2,(H,13,14)(H,15,16)
InChIKeyZQHVNBZNCQUSMS-UHFFFAOYSA-N
MW228.25 g/mol
LogP0.89
Rot. Bonds1

About 1,2-diazaspiro[4.5]decane-1,8-dicarboxylic acid

1,2-diazaspiro[4.5]decane-1,8-dicarboxylic acid (PubChem CID 152694765) has the molecular formula C10H16N2O4 and a molecular weight of 228.25 g/mol. Its IUPAC name is 1,2-diazaspiro[4.5]decane-1,8-dicarboxylic acid.

Molecular Properties

Compound Name1,2-diazaspiro[4.5]decane-1,8-dicarboxylic acid
PubChem CID152694765
Molecular FormulaC10H16N2O4
Molecular Weight228.25 g/mol
Exact Mass228.11
IUPAC Name1,2-diazaspiro[4.5]decane-1,8-dicarboxylic acid
SMILESO=C(O)C1CCC2(CCNN2C(=O)O)CC1
InChIInChI=1S/C10H16N2O4/c13-8(14)7-1-3-10(4-2-7)5-6-11-12(10)9(15)16/h7,11H,1-6H2,(H,13,14)(H,15,16)
InChIKeyZQHVNBZNCQUSMS-UHFFFAOYSA-N
XLogP0.89
TPSA89.87 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.25
LogP ≤ 50.89
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 1,2-diazaspiro[4.5]decane-1,8-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,2-diazaspiro[4.5]decane-1,8-dicarboxylic acid?
The IUPAC name of 1,2-diazaspiro[4.5]decane-1,8-dicarboxylic acid (CID 152694765) is 1,2-diazaspiro[4.5]decane-1,8-dicarboxylic acid.
What is the SMILES notation for 1,2-diazaspiro[4.5]decane-1,8-dicarboxylic acid?
The canonical SMILES for 1,2-diazaspiro[4.5]decane-1,8-dicarboxylic acid is O=C(O)C1CCC2(CCNN2C(=O)O)CC1.
What is the InChIKey of 1,2-diazaspiro[4.5]decane-1,8-dicarboxylic acid?
The InChIKey is ZQHVNBZNCQUSMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O4/c13-8(14)7-1-3-10(4-2-7)5-6-11-12(10)9(15)16/h7,11H,1-6H2,(H,13,14)(H,15,16).
What are the key properties of 1,2-diazaspiro[4.5]decane-1,8-dicarboxylic acid?
1,2-diazaspiro[4.5]decane-1,8-dicarboxylic acid has a molecular weight of 228.25 g/mol, XLogP of 0.89, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-diazaspiro[4.5]decane-1,8-dicarboxylic acid is sourced from PubChem (CID 152694765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).