About 5-[2-[4-(3-cyclohexylpropyl)-3-(trifluoromethyl)phenyl]ethyl]-2,2-dimethyl-4H-1,3-dioxine
5-[2-[4-(3-cyclohexylpropyl)-3-(trifluoromethyl)phenyl]ethyl]-2,2-dimethyl-4H-1,3-dioxine (PubChem CID 152700009) has the molecular formula C24H33F3O2
and a molecular weight of 410.52 g/mol. Its IUPAC name is 5-[2-[4-(3-cyclohexylpropyl)-3-(trifluoromethyl)phenyl]ethyl]-2,2-dimethyl-4H-1,3-dioxine.
Molecular Properties
| Compound Name | 5-[2-[4-(3-cyclohexylpropyl)-3-(trifluoromethyl)phenyl]ethyl]-2,2-dimethyl-4H-1,3-dioxine |
| PubChem CID | 152700009 |
| Molecular Formula | C24H33F3O2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | 5-[2-[4-(3-cyclohexylpropyl)-3-(trifluoromethyl)phenyl]ethyl]-2,2-dimethyl-4H-1,3-dioxine |
| SMILES | CC1(C)OC=C(CCc2ccc(CCCC3CCCCC3)c(C(F)(F)F)c2)CO1 |
| InChI | InChI=1S/C24H33F3O2/c1-23(2)28-16-20(17-29-23)12-11-19-13-14-21(22(15-19)24(25,26)27)10-6-9-18-7-4-3-5-8-18/h13-16,18H,3-12,17H2,1-2H3 |
| InChIKey | ZRJKNGMXJLMJEK-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[2-[4-(3-cyclohexylpropyl)-3-(trifluoromethyl)phenyl]ethyl]-2,2-dimethyl-4H-1,3-dioxine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-[4-(3-cyclohexylpropyl)-3-(trifluoromethyl)phenyl]ethyl]-2,2-dimethyl-4H-1,3-dioxine?
The IUPAC name of 5-[2-[4-(3-cyclohexylpropyl)-3-(trifluoromethyl)phenyl]ethyl]-2,2-dimethyl-4H-1,3-dioxine (CID 152700009) is 5-[2-[4-(3-cyclohexylpropyl)-3-(trifluoromethyl)phenyl]ethyl]-2,2-dimethyl-4H-1,3-dioxine.
What is the SMILES notation for 5-[2-[4-(3-cyclohexylpropyl)-3-(trifluoromethyl)phenyl]ethyl]-2,2-dimethyl-4H-1,3-dioxine?
The canonical SMILES for 5-[2-[4-(3-cyclohexylpropyl)-3-(trifluoromethyl)phenyl]ethyl]-2,2-dimethyl-4H-1,3-dioxine is CC1(C)OC=C(CCc2ccc(CCCC3CCCCC3)c(C(F)(F)F)c2)CO1.
What is the InChIKey of 5-[2-[4-(3-cyclohexylpropyl)-3-(trifluoromethyl)phenyl]ethyl]-2,2-dimethyl-4H-1,3-dioxine?
The InChIKey is ZRJKNGMXJLMJEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H33F3O2/c1-23(2)28-16-20(17-29-23)12-11-19-13-14-21(22(15-19)24(25,26)27)10-6-9-18-7-4-3-5-8-18/h13-16,18H,3-12,17H2,1-2H3.
What are the key properties of 5-[2-[4-(3-cyclohexylpropyl)-3-(trifluoromethyl)phenyl]ethyl]-2,2-dimethyl-4H-1,3-dioxine?
5-[2-[4-(3-cyclohexylpropyl)-3-(trifluoromethyl)phenyl]ethyl]-2,2-dimethyl-4H-1,3-dioxine has a molecular weight of 410.52 g/mol, XLogP of 7.21, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-[4-(3-cyclohexylpropyl)-3-(trifluoromethyl)phenyl]ethyl]-2,2-dimethyl-4H-1,3-dioxine is sourced from PubChem (CID 152700009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).