C13H17ClN2O — CID 15270209
2-chloro-N-propan-2-yl-5,6,7,8-tetrahydroquinoline-4-carboxamide (PubChem CID 15270209) has the molecular formula C13H17ClN2O and a molecular weight of 252.74 g/mol. Its IUPAC name is 2-chloro-N-propan-2-yl-5,6,7,8-tetrahydroquinoline-4-carboxamide.
| Compound Name | 2-chloro-N-propan-2-yl-5,6,7,8-tetrahydroquinoline-4-carboxamide |
|---|---|
| PubChem CID | 15270209 |
| Molecular Formula | C13H17ClN2O |
| Molecular Weight | 252.74 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 2-chloro-N-propan-2-yl-5,6,7,8-tetrahydroquinoline-4-carboxamide |
| SMILES | CC(C)NC(=O)c1cc(Cl)nc2c1CCCC2 |
| InChI | InChI=1S/C13H17ClN2O/c1-8(2)15-13(17)10-7-12(14)16-11-6-4-3-5-9(10)11/h7-8H,3-6H2,1-2H3,(H,15,17) |
| InChIKey | DMKWZADNVXJKJD-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.74 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|