C12H26O2 — CID 15270323
3-(ethoxymethyl)-2,2,4,4-tetramethylpentan-3-ol (PubChem CID 15270323) has the molecular formula C12H26O2 and a molecular weight of 202.34 g/mol. Its IUPAC name is 3-(ethoxymethyl)-2,2,4,4-tetramethylpentan-3-ol.
| Compound Name | 3-(ethoxymethyl)-2,2,4,4-tetramethylpentan-3-ol |
|---|---|
| PubChem CID | 15270323 |
| Molecular Formula | C12H26O2 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.19 |
| IUPAC Name | 3-(ethoxymethyl)-2,2,4,4-tetramethylpentan-3-ol |
| SMILES | CCOCC(O)(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C12H26O2/c1-8-14-9-12(13,10(2,3)4)11(5,6)7/h13H,8-9H2,1-7H3 |
| InChIKey | IJZDMKGNAZZNBB-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |