About 4-hydroxy-1,5-diphenylpentan-2-one
4-hydroxy-1,5-diphenylpentan-2-one (PubChem CID 15270459) has the molecular formula C17H18O2
and a molecular weight of 254.33 g/mol. Its IUPAC name is 4-hydroxy-1,5-diphenylpentan-2-one.
Molecular Properties
| Compound Name | 4-hydroxy-1,5-diphenylpentan-2-one |
| PubChem CID | 15270459 |
| Molecular Formula | C17H18O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 4-hydroxy-1,5-diphenylpentan-2-one |
| SMILES | O=C(Cc1ccccc1)CC(O)Cc1ccccc1 |
| InChI | InChI=1S/C17H18O2/c18-16(11-14-7-3-1-4-8-14)13-17(19)12-15-9-5-2-6-10-15/h1-10,16,18H,11-13H2 |
| InChIKey | RGWUKZCFNDLAOG-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-hydroxy-1,5-diphenylpentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-1,5-diphenylpentan-2-one?
The IUPAC name of 4-hydroxy-1,5-diphenylpentan-2-one (CID 15270459) is 4-hydroxy-1,5-diphenylpentan-2-one.
What is the SMILES notation for 4-hydroxy-1,5-diphenylpentan-2-one?
The canonical SMILES for 4-hydroxy-1,5-diphenylpentan-2-one is O=C(Cc1ccccc1)CC(O)Cc1ccccc1.
What is the InChIKey of 4-hydroxy-1,5-diphenylpentan-2-one?
The InChIKey is RGWUKZCFNDLAOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18O2/c18-16(11-14-7-3-1-4-8-14)13-17(19)12-15-9-5-2-6-10-15/h1-10,16,18H,11-13H2.
What are the key properties of 4-hydroxy-1,5-diphenylpentan-2-one?
4-hydroxy-1,5-diphenylpentan-2-one has a molecular weight of 254.33 g/mol, XLogP of 2.79, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-1,5-diphenylpentan-2-one is sourced from PubChem (CID 15270459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).