About 1,9-dibromothianthrene
1,9-dibromothianthrene (PubChem CID 15270537) has the molecular formula C12H6Br2S2
and a molecular weight of 374.12 g/mol. Its IUPAC name is 1,9-dibromothianthrene.
Molecular Properties
| Compound Name | 1,9-dibromothianthrene |
| PubChem CID | 15270537 |
| Molecular Formula | C12H6Br2S2 |
| Molecular Weight | 374.12 g/mol |
| Exact Mass | 371.83 |
| IUPAC Name | 1,9-dibromothianthrene |
| SMILES | Brc1cccc2c1Sc1c(Br)cccc1S2 |
| InChI | InChI=1S/C12H6Br2S2/c13-7-3-1-5-9-11(7)16-12-8(14)4-2-6-10(12)15-9/h1-6H |
| InChIKey | HVPWKHWYNUDUHH-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.12 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,9-dibromothianthrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,9-dibromothianthrene?
The IUPAC name of 1,9-dibromothianthrene (CID 15270537) is 1,9-dibromothianthrene.
What is the SMILES notation for 1,9-dibromothianthrene?
The canonical SMILES for 1,9-dibromothianthrene is Brc1cccc2c1Sc1c(Br)cccc1S2.
What is the InChIKey of 1,9-dibromothianthrene?
The InChIKey is HVPWKHWYNUDUHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6Br2S2/c13-7-3-1-5-9-11(7)16-12-8(14)4-2-6-10(12)15-9/h1-6H.
What are the key properties of 1,9-dibromothianthrene?
1,9-dibromothianthrene has a molecular weight of 374.12 g/mol, XLogP of 5.83, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,9-dibromothianthrene is sourced from PubChem (CID 15270537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).