C25H37F2N5O3 — CID 152706445
(2S)-2-[(4,4-difluorocyclohexanecarbonyl)amino]-4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-ylmethylamino)piperidin-1-yl]butanoic acid (PubChem CID 152706445) has the molecular formula C25H37F2N5O3 and a molecular weight of 493.60 g/mol. Its IUPAC name is (2S)-2-[(4,4-difluorocyclohexanecarbonyl)amino]-4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-ylmethylamino)piperidin-1-yl]butanoic acid.
| Compound Name | (2S)-2-[(4,4-difluorocyclohexanecarbonyl)amino]-4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-ylmethylamino)piperidin-1-yl]butanoic acid |
|---|---|
| PubChem CID | 152706445 |
| Molecular Formula | C25H37F2N5O3 |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.29 |
| IUPAC Name | (2S)-2-[(4,4-difluorocyclohexanecarbonyl)amino]-4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-ylmethylamino)piperidin-1-yl]butanoic acid |
| SMILES | O=C(N[C@@H](CCN1CCC(NCc2ccc3c(n2)NCCC3)CC1)C(=O)O)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C25H37F2N5O3/c26-25(27)10-5-18(6-11-25)23(33)31-21(24(34)35)9-15-32-13-7-19(8-14-32)29-16-20-4-3-17-2-1-12-28-22(17)30-20/h3-4,18-19,21,29H,1-2,5-16H2,(H,28,30)(H,31,33)(H,34,35)/t21-/m0/s1 |
| InChIKey | ZSRBTMDYNSWCQR-NRFANRHFSA-N |
| XLogP | 2.78 |
| TPSA | 106.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |