C23H25BrN2O3 — CID 15270871
1-(4-methoxyphenyl)-2-[3-(4-methoxyphenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-1-ium-1-yl]ethanone bromide (PubChem CID 15270871) has the molecular formula C23H25BrN2O3 and a molecular weight of 457.37 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-2-[3-(4-methoxyphenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-1-ium-1-yl]ethanone bromide.
| Compound Name | 1-(4-methoxyphenyl)-2-[3-(4-methoxyphenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-1-ium-1-yl]ethanone bromide |
|---|---|
| PubChem CID | 15270871 |
| Molecular Formula | C23H25BrN2O3 |
| Molecular Weight | 457.37 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | 1-(4-methoxyphenyl)-2-[3-(4-methoxyphenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-1-ium-1-yl]ethanone bromide |
| SMILES | COc1ccc(C(=O)C[n+]2cc(-c3ccc(OC)cc3)n3c2CCCC3)cc1.[Br-] |
| InChI | InChI=1S/C23H25N2O3.BrH/c1-27-19-10-6-17(7-11-19)21-15-24(23-5-3-4-14-25(21)23)16-22(26)18-8-12-20(28-2)13-9-18;/h6-13,15H,3-5,14,16H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | LZTNBRUINMYXEG-UHFFFAOYSA-M |
| XLogP | 0.68 |
| TPSA | 44.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.37 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|