C17H15F6N — CID 152709650
4-[2-[2-(1,1,1,3,3,3-hexafluoropropan-2-yl)phenyl]ethyl]aniline (PubChem CID 152709650) has the molecular formula C17H15F6N and a molecular weight of 347.30 g/mol. Its IUPAC name is 4-[2-[2-(1,1,1,3,3,3-hexafluoropropan-2-yl)phenyl]ethyl]aniline.
| Compound Name | 4-[2-[2-(1,1,1,3,3,3-hexafluoropropan-2-yl)phenyl]ethyl]aniline |
|---|---|
| PubChem CID | 152709650 |
| Molecular Formula | C17H15F6N |
| Molecular Weight | 347.30 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 4-[2-[2-(1,1,1,3,3,3-hexafluoropropan-2-yl)phenyl]ethyl]aniline |
| SMILES | Nc1ccc(CCc2ccccc2C(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H15F6N/c18-16(19,20)15(17(21,22)23)14-4-2-1-3-12(14)8-5-11-6-9-13(24)10-7-11/h1-4,6-7,9-10,15H,5,8,24H2 |
| InChIKey | ZTIHCSSCXVVNEB-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.30 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|