C10H11F3N2O4S — CID 152709883
(E)-N-ethoxy-1-[2-(3,4,4-trifluorobut-3-enylsulfonyl)-1,3-oxazol-5-yl]methanimine (PubChem CID 152709883) has the molecular formula C10H11F3N2O4S and a molecular weight of 312.27 g/mol. Its IUPAC name is (E)-N-ethoxy-1-[2-(3,4,4-trifluorobut-3-enylsulfonyl)-1,3-oxazol-5-yl]methanimine.
| Compound Name | (E)-N-ethoxy-1-[2-(3,4,4-trifluorobut-3-enylsulfonyl)-1,3-oxazol-5-yl]methanimine |
|---|---|
| PubChem CID | 152709883 |
| Molecular Formula | C10H11F3N2O4S |
| Molecular Weight | 312.27 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | (E)-N-ethoxy-1-[2-(3,4,4-trifluorobut-3-enylsulfonyl)-1,3-oxazol-5-yl]methanimine |
| SMILES | CCO/N=C/c1cnc(S(=O)(=O)CCC(F)=C(F)F)o1 |
| InChI | InChI=1S/C10H11F3N2O4S/c1-2-18-15-6-7-5-14-10(19-7)20(16,17)4-3-8(11)9(12)13/h5-6H,2-4H2,1H3/b15-6+ |
| InChIKey | ZTJKZNMBBHKFCK-GIDUJCDVSA-N |
| XLogP | 2.29 |
| TPSA | 81.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.27 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|