C28H38O4 — CID 152710252
[2-(6-methylheptanoyloxy)-3-phenylphenyl] 6-methylheptanoate (PubChem CID 152710252) has the molecular formula C28H38O4 and a molecular weight of 438.61 g/mol. Its IUPAC name is [2-(6-methylheptanoyloxy)-3-phenylphenyl] 6-methylheptanoate.
| Compound Name | [2-(6-methylheptanoyloxy)-3-phenylphenyl] 6-methylheptanoate |
|---|---|
| PubChem CID | 152710252 |
| Molecular Formula | C28H38O4 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.28 |
| IUPAC Name | [2-(6-methylheptanoyloxy)-3-phenylphenyl] 6-methylheptanoate |
| SMILES | CC(C)CCCCC(=O)Oc1cccc(-c2ccccc2)c1OC(=O)CCCCC(C)C |
| InChI | InChI=1S/C28H38O4/c1-21(2)13-8-10-19-26(29)31-25-18-12-17-24(23-15-6-5-7-16-23)28(25)32-27(30)20-11-9-14-22(3)4/h5-7,12,15-18,21-22H,8-11,13-14,19-20H2,1-4H3 |
| InChIKey | ZTLLKYKLFYISPE-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|