C22H39NO2Si2 — CID 15271131
[(3R,4S)-4-[benzyl(trimethylsilylmethyl)amino]-2-(trimethylsilylmethyl)pent-1-en-3-yl] acetate (PubChem CID 15271131) has the molecular formula C22H39NO2Si2 and a molecular weight of 405.73 g/mol. Its IUPAC name is [(3R,4S)-4-[benzyl(trimethylsilylmethyl)amino]-2-(trimethylsilylmethyl)pent-1-en-3-yl] acetate.
| Compound Name | [(3R,4S)-4-[benzyl(trimethylsilylmethyl)amino]-2-(trimethylsilylmethyl)pent-1-en-3-yl] acetate |
|---|---|
| PubChem CID | 15271131 |
| Molecular Formula | C22H39NO2Si2 |
| Molecular Weight | 405.73 g/mol |
| Exact Mass | 405.25 |
| IUPAC Name | [(3R,4S)-4-[benzyl(trimethylsilylmethyl)amino]-2-(trimethylsilylmethyl)pent-1-en-3-yl] acetate |
| SMILES | C=C(C[Si](C)(C)C)[C@@H](OC(C)=O)[C@H](C)N(Cc1ccccc1)C[Si](C)(C)C |
| InChI | InChI=1S/C22H39NO2Si2/c1-18(16-26(4,5)6)22(25-20(3)24)19(2)23(17-27(7,8)9)15-21-13-11-10-12-14-21/h10-14,19,22H,1,15-17H2,2-9H3/t19-,22+/m0/s1 |
| InChIKey | HPHRKWIXIDTNTA-SIKLNZKXSA-N |
| XLogP | 5.58 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.73 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|