C15H17NO3 — CID 15271140
[(2S,3R)-1-benzoyl-2-methyl-3,6-dihydro-2H-pyridin-3-yl] acetate (PubChem CID 15271140) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is [(2S,3R)-1-benzoyl-2-methyl-3,6-dihydro-2H-pyridin-3-yl] acetate.
| Compound Name | [(2S,3R)-1-benzoyl-2-methyl-3,6-dihydro-2H-pyridin-3-yl] acetate |
|---|---|
| PubChem CID | 15271140 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | [(2S,3R)-1-benzoyl-2-methyl-3,6-dihydro-2H-pyridin-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C=CCN(C(=O)c2ccccc2)[C@H]1C |
| InChI | InChI=1S/C15H17NO3/c1-11-14(19-12(2)17)9-6-10-16(11)15(18)13-7-4-3-5-8-13/h3-9,11,14H,10H2,1-2H3/t11-,14+/m0/s1 |
| InChIKey | GOLYPSDUALDFDB-SMDDNHRTSA-N |
| XLogP | 2.02 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|