About [2-carbamoyloxy-2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl] carbamate
[2-carbamoyloxy-2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl] carbamate (PubChem CID 152711666) has the molecular formula C9H14N4O5
and a molecular weight of 258.23 g/mol. Its IUPAC name is [2-carbamoyloxy-2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl] carbamate.
Molecular Properties
| Compound Name | [2-carbamoyloxy-2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl] carbamate |
| PubChem CID | 152711666 |
| Molecular Formula | C9H14N4O5 |
| Molecular Weight | 258.23 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | [2-carbamoyloxy-2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl] carbamate |
| SMILES | CC(C)c1noc(C(COC(N)=O)OC(N)=O)n1 |
| InChI | InChI=1S/C9H14N4O5/c1-4(2)6-12-7(18-13-6)5(17-9(11)15)3-16-8(10)14/h4-5H,3H2,1-2H3,(H2,10,14)(H2,11,15) |
| InChIKey | ZTSREHUZVHVIHS-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 143.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.23 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [2-carbamoyloxy-2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-carbamoyloxy-2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl] carbamate?
The IUPAC name of [2-carbamoyloxy-2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl] carbamate (CID 152711666) is [2-carbamoyloxy-2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl] carbamate.
What is the SMILES notation for [2-carbamoyloxy-2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl] carbamate?
The canonical SMILES for [2-carbamoyloxy-2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl] carbamate is CC(C)c1noc(C(COC(N)=O)OC(N)=O)n1.
What is the InChIKey of [2-carbamoyloxy-2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl] carbamate?
The InChIKey is ZTSREHUZVHVIHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N4O5/c1-4(2)6-12-7(18-13-6)5(17-9(11)15)3-16-8(10)14/h4-5H,3H2,1-2H3,(H2,10,14)(H2,11,15).
What are the key properties of [2-carbamoyloxy-2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl] carbamate?
[2-carbamoyloxy-2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl] carbamate has a molecular weight of 258.23 g/mol, XLogP of 0.42, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-carbamoyloxy-2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl] carbamate is sourced from PubChem (CID 152711666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).