C27H32F3N3O3 — CID 152714327
[[5-[1-[4-(trifluoromethyl)phenyl]piperidin-4-yl]oxy-2,3-dihydro-1H-inden-1-yl]amino] piperidine-1-carboxylate (PubChem CID 152714327) has the molecular formula C27H32F3N3O3 and a molecular weight of 503.57 g/mol. Its IUPAC name is [[5-[1-[4-(trifluoromethyl)phenyl]piperidin-4-yl]oxy-2,3-dihydro-1H-inden-1-yl]amino] piperidine-1-carboxylate.
| Compound Name | [[5-[1-[4-(trifluoromethyl)phenyl]piperidin-4-yl]oxy-2,3-dihydro-1H-inden-1-yl]amino] piperidine-1-carboxylate |
|---|---|
| PubChem CID | 152714327 |
| Molecular Formula | C27H32F3N3O3 |
| Molecular Weight | 503.57 g/mol |
| Exact Mass | 503.24 |
| IUPAC Name | [[5-[1-[4-(trifluoromethyl)phenyl]piperidin-4-yl]oxy-2,3-dihydro-1H-inden-1-yl]amino] piperidine-1-carboxylate |
| SMILES | O=C(ONC1CCc2cc(OC3CCN(c4ccc(C(F)(F)F)cc4)CC3)ccc21)N1CCCCC1 |
| InChI | InChI=1S/C27H32F3N3O3/c28-27(29,30)20-5-7-21(8-6-20)32-16-12-22(13-17-32)35-23-9-10-24-19(18-23)4-11-25(24)31-36-26(34)33-14-2-1-3-15-33/h5-10,18,22,25,31H,1-4,11-17H2 |
| InChIKey | ZUGWTUZXARGKBH-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.57 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|