About 4-(1,3-benzodioxol-5-ylmethyl)-2-(2-propoxyphenyl)quinazolin-5-amine
4-(1,3-benzodioxol-5-ylmethyl)-2-(2-propoxyphenyl)quinazolin-5-amine (PubChem CID 152714961) has the molecular formula C25H23N3O3
and a molecular weight of 413.48 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-ylmethyl)-2-(2-propoxyphenyl)quinazolin-5-amine.
Molecular Properties
| Compound Name | 4-(1,3-benzodioxol-5-ylmethyl)-2-(2-propoxyphenyl)quinazolin-5-amine |
| PubChem CID | 152714961 |
| Molecular Formula | C25H23N3O3 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | 4-(1,3-benzodioxol-5-ylmethyl)-2-(2-propoxyphenyl)quinazolin-5-amine |
| SMILES | CCCOc1ccccc1-c1nc(Cc2ccc3c(c2)OCO3)c2c(N)cccc2n1 |
| InChI | InChI=1S/C25H23N3O3/c1-2-12-29-21-9-4-3-6-17(21)25-27-19-8-5-7-18(26)24(19)20(28-25)13-16-10-11-22-23(14-16)31-15-30-22/h3-11,14H,2,12-13,15,26H2,1H3 |
| InChIKey | ZUKDDXCZQPSGNZ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 79.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(1,3-benzodioxol-5-ylmethyl)-2-(2-propoxyphenyl)quinazolin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-benzodioxol-5-ylmethyl)-2-(2-propoxyphenyl)quinazolin-5-amine?
The IUPAC name of 4-(1,3-benzodioxol-5-ylmethyl)-2-(2-propoxyphenyl)quinazolin-5-amine (CID 152714961) is 4-(1,3-benzodioxol-5-ylmethyl)-2-(2-propoxyphenyl)quinazolin-5-amine.
What is the SMILES notation for 4-(1,3-benzodioxol-5-ylmethyl)-2-(2-propoxyphenyl)quinazolin-5-amine?
The canonical SMILES for 4-(1,3-benzodioxol-5-ylmethyl)-2-(2-propoxyphenyl)quinazolin-5-amine is CCCOc1ccccc1-c1nc(Cc2ccc3c(c2)OCO3)c2c(N)cccc2n1.
What is the InChIKey of 4-(1,3-benzodioxol-5-ylmethyl)-2-(2-propoxyphenyl)quinazolin-5-amine?
The InChIKey is ZUKDDXCZQPSGNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H23N3O3/c1-2-12-29-21-9-4-3-6-17(21)25-27-19-8-5-7-18(26)24(19)20(28-25)13-16-10-11-22-23(14-16)31-15-30-22/h3-11,14H,2,12-13,15,26H2,1H3.
What are the key properties of 4-(1,3-benzodioxol-5-ylmethyl)-2-(2-propoxyphenyl)quinazolin-5-amine?
4-(1,3-benzodioxol-5-ylmethyl)-2-(2-propoxyphenyl)quinazolin-5-amine has a molecular weight of 413.48 g/mol, XLogP of 4.99, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-benzodioxol-5-ylmethyl)-2-(2-propoxyphenyl)quinazolin-5-amine is sourced from PubChem (CID 152714961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).