C28H33ClN4O3 — CID 152715090
tert-butyl 4-chloro-1-[4-(3-methylphenoxy)cyclohexyl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine-5-carboxylate (PubChem CID 152715090) has the molecular formula C28H33ClN4O3 and a molecular weight of 509.05 g/mol. Its IUPAC name is tert-butyl 4-chloro-1-[4-(3-methylphenoxy)cyclohexyl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine-5-carboxylate.
| Compound Name | tert-butyl 4-chloro-1-[4-(3-methylphenoxy)cyclohexyl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine-5-carboxylate |
|---|---|
| PubChem CID | 152715090 |
| Molecular Formula | C28H33ClN4O3 |
| Molecular Weight | 509.05 g/mol |
| Exact Mass | 508.22 |
| IUPAC Name | tert-butyl 4-chloro-1-[4-(3-methylphenoxy)cyclohexyl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine-5-carboxylate |
| SMILES | Cc1cccc(OC2CCC(c3nnc4n3-c3ccccc3CN(C(=O)OC(C)(C)C)C4Cl)CC2)c1 |
| InChI | InChI=1S/C28H33ClN4O3/c1-18-8-7-10-22(16-18)35-21-14-12-19(13-15-21)25-30-31-26-24(29)32(27(34)36-28(2,3)4)17-20-9-5-6-11-23(20)33(25)26/h5-11,16,19,21,24H,12-15,17H2,1-4H3 |
| InChIKey | ZUKUSIWQXZJRFD-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.05 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|