About 1-bromo-3,6-ditert-butyl-9H-fluorene
1-bromo-3,6-ditert-butyl-9H-fluorene (PubChem CID 152720081) has the molecular formula C21H25Br
and a molecular weight of 357.34 g/mol. Its IUPAC name is 1-bromo-3,6-ditert-butyl-9H-fluorene.
Molecular Properties
| Compound Name | 1-bromo-3,6-ditert-butyl-9H-fluorene |
| PubChem CID | 152720081 |
| Molecular Formula | C21H25Br |
| Molecular Weight | 357.34 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 1-bromo-3,6-ditert-butyl-9H-fluorene |
| SMILES | CC(C)(C)c1ccc2c(c1)-c1cc(C(C)(C)C)cc(Br)c1C2 |
| InChI | InChI=1S/C21H25Br/c1-20(2,3)14-8-7-13-9-18-17(16(13)10-14)11-15(12-19(18)22)21(4,5)6/h7-8,10-12H,9H2,1-6H3 |
| InChIKey | ZVLBDIXNVKIPCN-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 357.34 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-bromo-3,6-ditert-butyl-9H-fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-3,6-ditert-butyl-9H-fluorene?
The IUPAC name of 1-bromo-3,6-ditert-butyl-9H-fluorene (CID 152720081) is 1-bromo-3,6-ditert-butyl-9H-fluorene.
What is the SMILES notation for 1-bromo-3,6-ditert-butyl-9H-fluorene?
The canonical SMILES for 1-bromo-3,6-ditert-butyl-9H-fluorene is CC(C)(C)c1ccc2c(c1)-c1cc(C(C)(C)C)cc(Br)c1C2.
What is the InChIKey of 1-bromo-3,6-ditert-butyl-9H-fluorene?
The InChIKey is ZVLBDIXNVKIPCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25Br/c1-20(2,3)14-8-7-13-9-18-17(16(13)10-14)11-15(12-19(18)22)21(4,5)6/h7-8,10-12H,9H2,1-6H3.
What are the key properties of 1-bromo-3,6-ditert-butyl-9H-fluorene?
1-bromo-3,6-ditert-butyl-9H-fluorene has a molecular weight of 357.34 g/mol, XLogP of 6.62, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-3,6-ditert-butyl-9H-fluorene is sourced from PubChem (CID 152720081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).