About 2-(1,2,3,6-tetrahydropyrazin-5-yl)but-1-en-1-amine
2-(1,2,3,6-tetrahydropyrazin-5-yl)but-1-en-1-amine (PubChem CID 152721867) has the molecular formula C8H15N3
and a molecular weight of 153.23 g/mol. Its IUPAC name is 2-(1,2,3,6-tetrahydropyrazin-5-yl)but-1-en-1-amine.
Analyze 2-(1,2,3,6-tetrahydropyrazin-5-yl)but-1-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,2,3,6-tetrahydropyrazin-5-yl)but-1-en-1-amine?
The IUPAC name of 2-(1,2,3,6-tetrahydropyrazin-5-yl)but-1-en-1-amine (CID 152721867) is 2-(1,2,3,6-tetrahydropyrazin-5-yl)but-1-en-1-amine.
What is the SMILES notation for 2-(1,2,3,6-tetrahydropyrazin-5-yl)but-1-en-1-amine?
The canonical SMILES for 2-(1,2,3,6-tetrahydropyrazin-5-yl)but-1-en-1-amine is CCC(=CN)C1=NCCNC1.
What is the InChIKey of 2-(1,2,3,6-tetrahydropyrazin-5-yl)but-1-en-1-amine?
The InChIKey is AOENPUGVKLOVLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3/c1-2-7(5-9)8-6-10-3-4-11-8/h5,10H,2-4,6,9H2,1H3.
What are the key properties of 2-(1,2,3,6-tetrahydropyrazin-5-yl)but-1-en-1-amine?
2-(1,2,3,6-tetrahydropyrazin-5-yl)but-1-en-1-amine has a molecular weight of 153.23 g/mol, XLogP of 0.28, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,2,3,6-tetrahydropyrazin-5-yl)but-1-en-1-amine is sourced from PubChem (CID 152721867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).