C19H13F13IO2- — CID 152723185
5-iodo-2-(7,7,8,8,9,9,10,10,11,11,12,12,12-tridecafluorododec-5-enyl)benzoate (PubChem CID 152723185) has the molecular formula C19H13F13IO2- and a molecular weight of 647.19 g/mol. Its IUPAC name is 5-iodo-2-(7,7,8,8,9,9,10,10,11,11,12,12,12-tridecafluorododec-5-enyl)benzoate.
| Compound Name | 5-iodo-2-(7,7,8,8,9,9,10,10,11,11,12,12,12-tridecafluorododec-5-enyl)benzoate |
|---|---|
| PubChem CID | 152723185 |
| Molecular Formula | C19H13F13IO2- |
| Molecular Weight | 647.19 g/mol |
| Exact Mass | 646.98 |
| IUPAC Name | 5-iodo-2-(7,7,8,8,9,9,10,10,11,11,12,12,12-tridecafluorododec-5-enyl)benzoate |
| SMILES | O=C([O-])c1cc(I)ccc1CCCCC=CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C19H14F13IO2/c20-14(21,15(22,23)16(24,25)17(26,27)18(28,29)19(30,31)32)8-4-2-1-3-5-10-6-7-11(33)9-12(10)13(34)35/h4,6-9H,1-3,5H2,(H,34,35)/p-1 |
| InChIKey | ZWAWMOYOKDYZAD-UHFFFAOYSA-M |
| XLogP | 6.66 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.19 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|