C13H8BrF7O — CID 152725801
3-bromo-2,2-bis(fluoromethyl)-6-(1,1,2,2,2-pentafluoroethyl)chromene (PubChem CID 152725801) has the molecular formula C13H8BrF7O and a molecular weight of 393.10 g/mol. Its IUPAC name is 3-bromo-2,2-bis(fluoromethyl)-6-(1,1,2,2,2-pentafluoroethyl)chromene.
| Compound Name | 3-bromo-2,2-bis(fluoromethyl)-6-(1,1,2,2,2-pentafluoroethyl)chromene |
|---|---|
| PubChem CID | 152725801 |
| Molecular Formula | C13H8BrF7O |
| Molecular Weight | 393.10 g/mol |
| Exact Mass | 391.96 |
| IUPAC Name | 3-bromo-2,2-bis(fluoromethyl)-6-(1,1,2,2,2-pentafluoroethyl)chromene |
| SMILES | FCC1(CF)Oc2ccc(C(F)(F)C(F)(F)F)cc2C=C1Br |
| InChI | InChI=1S/C13H8BrF7O/c14-10-4-7-3-8(12(17,18)13(19,20)21)1-2-9(7)22-11(10,5-15)6-16/h1-4H,5-6H2 |
| InChIKey | ZWOMWMTZFBMEAW-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.10 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|