C26H42S2 — CID 15272748
2,4-ditert-butyl-1-[(2,4-ditert-butylcyclopenta-1,3-dien-1-yl)disulfanyl]cyclopenta-1,3-diene (PubChem CID 15272748) has the molecular formula C26H42S2 and a molecular weight of 418.76 g/mol. Its IUPAC name is 2,4-ditert-butyl-1-[(2,4-ditert-butylcyclopenta-1,3-dien-1-yl)disulfanyl]cyclopenta-1,3-diene.
| Compound Name | 2,4-ditert-butyl-1-[(2,4-ditert-butylcyclopenta-1,3-dien-1-yl)disulfanyl]cyclopenta-1,3-diene |
|---|---|
| PubChem CID | 15272748 |
| Molecular Formula | C26H42S2 |
| Molecular Weight | 418.76 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | 2,4-ditert-butyl-1-[(2,4-ditert-butylcyclopenta-1,3-dien-1-yl)disulfanyl]cyclopenta-1,3-diene |
| SMILES | CC(C)(C)C1=CC(C(C)(C)C)=C(SSC2=C(C(C)(C)C)C=C(C(C)(C)C)C2)C1 |
| InChI | InChI=1S/C26H42S2/c1-23(2,3)17-13-19(25(7,8)9)21(15-17)27-28-22-16-18(24(4,5)6)14-20(22)26(10,11)12/h13-14H,15-16H2,1-12H3 |
| InChIKey | SQXXKITZGMXVKS-UHFFFAOYSA-N |
| XLogP | 9.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.76 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|