C39H81P — CID 152732477
tris(10,10-dimethylundecyl)phosphane (PubChem CID 152732477) has the molecular formula C39H81P and a molecular weight of 581.05 g/mol. Its IUPAC name is tris(10,10-dimethylundecyl)phosphane.
| Compound Name | tris(10,10-dimethylundecyl)phosphane |
|---|---|
| PubChem CID | 152732477 |
| Molecular Formula | C39H81P |
| Molecular Weight | 581.05 g/mol |
| Exact Mass | 580.61 |
| IUPAC Name | tris(10,10-dimethylundecyl)phosphane |
| SMILES | CC(C)(C)CCCCCCCCCP(CCCCCCCCCC(C)(C)C)CCCCCCCCCC(C)(C)C |
| InChI | InChI=1S/C39H81P/c1-37(2,3)31-25-19-13-10-16-22-28-34-40(35-29-23-17-11-14-20-26-32-38(4,5)6)36-30-24-18-12-15-21-27-33-39(7,8)9/h10-36H2,1-9H3 |
| InChIKey | ZXXKIYZOZANGNS-UHFFFAOYSA-N |
| XLogP | 14.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 27 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.05 |
| LogP ≤ 5 | 14.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|