C12H18N4S — CID 152732929
4-(1,4-diaminocyclohexa-2,4-dien-1-yl)sulfanylcyclohexa-1,5-diene-1,4-diamine (PubChem CID 152732929) has the molecular formula C12H18N4S and a molecular weight of 250.37 g/mol. Its IUPAC name is 4-(1,4-diaminocyclohexa-2,4-dien-1-yl)sulfanylcyclohexa-1,5-diene-1,4-diamine.
| Compound Name | 4-(1,4-diaminocyclohexa-2,4-dien-1-yl)sulfanylcyclohexa-1,5-diene-1,4-diamine |
|---|---|
| PubChem CID | 152732929 |
| Molecular Formula | C12H18N4S |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 4-(1,4-diaminocyclohexa-2,4-dien-1-yl)sulfanylcyclohexa-1,5-diene-1,4-diamine |
| SMILES | NC1=CCC(N)(SC2(N)C=CC(N)=CC2)C=C1 |
| InChI | InChI=1S/C12H18N4S/c13-9-1-5-11(15,6-2-9)17-12(16)7-3-10(14)4-8-12/h1-5,7H,6,8,13-16H2 |
| InChIKey | ZXZRPYCKCGXPHZ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|