C15H20BrFN2O2 — CID 152737070
tert-butyl 4-(6-bromo-2-pyridinyl)-4-fluoropiperidine-1-carboxylate (PubChem CID 152737070) has the molecular formula C15H20BrFN2O2 and a molecular weight of 359.24 g/mol. Its IUPAC name is tert-butyl 4-(6-bromo-2-pyridinyl)-4-fluoropiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(6-bromo-2-pyridinyl)-4-fluoropiperidine-1-carboxylate |
|---|---|
| PubChem CID | 152737070 |
| Molecular Formula | C15H20BrFN2O2 |
| Molecular Weight | 359.24 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | tert-butyl 4-(6-bromo-2-pyridinyl)-4-fluoropiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(F)(c2cccc(Br)n2)CC1 |
| InChI | InChI=1S/C15H20BrFN2O2/c1-14(2,3)21-13(20)19-9-7-15(17,8-10-19)11-5-4-6-12(16)18-11/h4-6H,7-10H2,1-3H3 |
| InChIKey | ZYVIDSHXIIQKLX-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.24 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|