About 4-N'-iodobutanediimidamide
4-N'-iodobutanediimidamide (PubChem CID 152737407) has the molecular formula C4H9IN4
and a molecular weight of 240.05 g/mol. Its IUPAC name is 4-N'-iodobutanediimidamide.
Molecular Properties
| Compound Name | 4-N'-iodobutanediimidamide |
| PubChem CID | 152737407 |
| Molecular Formula | C4H9IN4 |
| Molecular Weight | 240.05 g/mol |
| Exact Mass | 239.99 |
| IUPAC Name | 4-N'-iodobutanediimidamide |
| SMILES | [H]/N=C(\N)CCC(N)=NI |
| InChI | InChI=1S/C4H9IN4/c5-9-4(8)2-1-3(6)7/h1-2H2,(H3,6,7)(H2,8,9) |
| InChIKey | ZYWVZINVJXROMG-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.05 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-N'-iodobutanediimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N'-iodobutanediimidamide?
The IUPAC name of 4-N'-iodobutanediimidamide (CID 152737407) is 4-N'-iodobutanediimidamide.
What is the SMILES notation for 4-N'-iodobutanediimidamide?
The canonical SMILES for 4-N'-iodobutanediimidamide is [H]/N=C(\N)CCC(N)=NI.
What is the InChIKey of 4-N'-iodobutanediimidamide?
The InChIKey is ZYWVZINVJXROMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9IN4/c5-9-4(8)2-1-3(6)7/h1-2H2,(H3,6,7)(H2,8,9).
What are the key properties of 4-N'-iodobutanediimidamide?
4-N'-iodobutanediimidamide has a molecular weight of 240.05 g/mol, XLogP of 0.41, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N'-iodobutanediimidamide is sourced from PubChem (CID 152737407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).