aminooxysulfonylsulfamic acid

H4N2O6S2 — CID 152738102

IUPACaminooxysulfonylsulfamic acid
SMILESNOS(=O)(=O)NS(=O)(=O)O
InChIInChI=1S/H4N2O6S2/c1-8-10(6,7)2-9(3,4)5/h2H,1H2,(H,3,4,5)
InChIKeyOHPKMHAABOWWDR-UHFFFAOYSA-N
MW192.17 g/mol
LogP-2.49
Rot. Bonds3

About aminooxysulfonylsulfamic acid

aminooxysulfonylsulfamic acid (PubChem CID 152738102) has the molecular formula H4N2O6S2 and a molecular weight of 192.17 g/mol. Its IUPAC name is aminooxysulfonylsulfamic acid.

Molecular Properties

Compound Nameaminooxysulfonylsulfamic acid
PubChem CID152738102
Molecular FormulaH4N2O6S2
Molecular Weight192.17 g/mol
Exact Mass191.95
IUPAC Nameaminooxysulfonylsulfamic acid
SMILESNOS(=O)(=O)NS(=O)(=O)O
InChIInChI=1S/H4N2O6S2/c1-8-10(6,7)2-9(3,4)5/h2H,1H2,(H,3,4,5)
InChIKeyOHPKMHAABOWWDR-UHFFFAOYSA-N
XLogP-2.49
TPSA135.79 Ų
H-Bond Donors3
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500192.17
LogP ≤ 5-2.49
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze aminooxysulfonylsulfamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of aminooxysulfonylsulfamic acid?
The IUPAC name of aminooxysulfonylsulfamic acid (CID 152738102) is aminooxysulfonylsulfamic acid.
What is the SMILES notation for aminooxysulfonylsulfamic acid?
The canonical SMILES for aminooxysulfonylsulfamic acid is NOS(=O)(=O)NS(=O)(=O)O.
What is the InChIKey of aminooxysulfonylsulfamic acid?
The InChIKey is OHPKMHAABOWWDR-UHFFFAOYSA-N. The full InChI is InChI=1S/H4N2O6S2/c1-8-10(6,7)2-9(3,4)5/h2H,1H2,(H,3,4,5).
What are the key properties of aminooxysulfonylsulfamic acid?
aminooxysulfonylsulfamic acid has a molecular weight of 192.17 g/mol, XLogP of -2.49, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for aminooxysulfonylsulfamic acid is sourced from PubChem (CID 152738102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).