C10H14O3 — CID 15273947
2,5-dimethyl-2-(3-oxobutyl)furan-3-one (PubChem CID 15273947) has the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. Its IUPAC name is 2,5-dimethyl-2-(3-oxobutyl)furan-3-one.
| Compound Name | 2,5-dimethyl-2-(3-oxobutyl)furan-3-one |
|---|---|
| PubChem CID | 15273947 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 2,5-dimethyl-2-(3-oxobutyl)furan-3-one |
| SMILES | CC(=O)CCC1(C)OC(C)=CC1=O |
| InChI | InChI=1S/C10H14O3/c1-7(11)4-5-10(3)9(12)6-8(2)13-10/h6H,4-5H2,1-3H3 |
| InChIKey | WEGFTQFOOLRZAN-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |