C19H15F3N2O2 — CID 152740170
2-[ethyl-[7-(trifluoromethyl)quinolin-4-yl]amino]benzoic acid (PubChem CID 152740170) has the molecular formula C19H15F3N2O2 and a molecular weight of 360.34 g/mol. Its IUPAC name is 2-[ethyl-[7-(trifluoromethyl)quinolin-4-yl]amino]benzoic acid.
| Compound Name | 2-[ethyl-[7-(trifluoromethyl)quinolin-4-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 152740170 |
| Molecular Formula | C19H15F3N2O2 |
| Molecular Weight | 360.34 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 2-[ethyl-[7-(trifluoromethyl)quinolin-4-yl]amino]benzoic acid |
| SMILES | CCN(c1ccccc1C(=O)O)c1ccnc2cc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C19H15F3N2O2/c1-2-24(16-6-4-3-5-14(16)18(25)26)17-9-10-23-15-11-12(19(20,21)22)7-8-13(15)17/h3-11H,2H2,1H3,(H,25,26) |
| InChIKey | ZZLJENWUQSJMCQ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.34 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |