About 2,3-dichloro-1,1-difluoropent-2-ene
2,3-dichloro-1,1-difluoropent-2-ene (PubChem CID 152741114) has the molecular formula C5H6Cl2F2
and a molecular weight of 175.01 g/mol. Its IUPAC name is 2,3-dichloro-1,1-difluoropent-2-ene.
Molecular Properties
| Compound Name | 2,3-dichloro-1,1-difluoropent-2-ene |
| PubChem CID | 152741114 |
| Molecular Formula | C5H6Cl2F2 |
| Molecular Weight | 175.01 g/mol |
| Exact Mass | 173.98 |
| IUPAC Name | 2,3-dichloro-1,1-difluoropent-2-ene |
| SMILES | CCC(Cl)=C(Cl)C(F)F |
| InChI | InChI=1S/C5H6Cl2F2/c1-2-3(6)4(7)5(8)9/h5H,2H2,1H3 |
| InChIKey | ZZPZETKVDQEKPH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.01 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2,3-dichloro-1,1-difluoropent-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dichloro-1,1-difluoropent-2-ene?
The IUPAC name of 2,3-dichloro-1,1-difluoropent-2-ene (CID 152741114) is 2,3-dichloro-1,1-difluoropent-2-ene.
What is the SMILES notation for 2,3-dichloro-1,1-difluoropent-2-ene?
The canonical SMILES for 2,3-dichloro-1,1-difluoropent-2-ene is CCC(Cl)=C(Cl)C(F)F.
What is the InChIKey of 2,3-dichloro-1,1-difluoropent-2-ene?
The InChIKey is ZZPZETKVDQEKPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6Cl2F2/c1-2-3(6)4(7)5(8)9/h5H,2H2,1H3.
What are the key properties of 2,3-dichloro-1,1-difluoropent-2-ene?
2,3-dichloro-1,1-difluoropent-2-ene has a molecular weight of 175.01 g/mol, XLogP of 3.35, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dichloro-1,1-difluoropent-2-ene is sourced from PubChem (CID 152741114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).