About 5-fluorohept-5-enal
5-fluorohept-5-enal (PubChem CID 152742286) has the molecular formula C7H11FO
and a molecular weight of 130.16 g/mol. Its IUPAC name is 5-fluorohept-5-enal.
Molecular Properties
| Compound Name | 5-fluorohept-5-enal |
| PubChem CID | 152742286 |
| Molecular Formula | C7H11FO |
| Molecular Weight | 130.16 g/mol |
| Exact Mass | 130.08 |
| IUPAC Name | 5-fluorohept-5-enal |
| SMILES | CC=C(F)CCCC=O |
| InChI | InChI=1S/C7H11FO/c1-2-7(8)5-3-4-6-9/h2,6H,3-5H2,1H3 |
| InChIKey | ZZWAQYMVSVJWCR-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.16 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-fluorohept-5-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluorohept-5-enal?
The IUPAC name of 5-fluorohept-5-enal (CID 152742286) is 5-fluorohept-5-enal.
What is the SMILES notation for 5-fluorohept-5-enal?
The canonical SMILES for 5-fluorohept-5-enal is CC=C(F)CCCC=O.
What is the InChIKey of 5-fluorohept-5-enal?
The InChIKey is ZZWAQYMVSVJWCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11FO/c1-2-7(8)5-3-4-6-9/h2,6H,3-5H2,1H3.
What are the key properties of 5-fluorohept-5-enal?
5-fluorohept-5-enal has a molecular weight of 130.16 g/mol, XLogP of 2.23, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluorohept-5-enal is sourced from PubChem (CID 152742286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).