C11H14O6 — CID 152743423
2-[(2R,4S)-3-ethylidene-2-hydroxy-5-methoxycarbonyl-4H-pyran-4-yl]acetic acid (PubChem CID 152743423) has the molecular formula C11H14O6 and a molecular weight of 242.23 g/mol. Its IUPAC name is 2-[(2R,4S)-3-ethylidene-2-hydroxy-5-methoxycarbonyl-4H-pyran-4-yl]acetic acid.
| Compound Name | 2-[(2R,4S)-3-ethylidene-2-hydroxy-5-methoxycarbonyl-4H-pyran-4-yl]acetic acid |
|---|---|
| PubChem CID | 152743423 |
| Molecular Formula | C11H14O6 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 2-[(2R,4S)-3-ethylidene-2-hydroxy-5-methoxycarbonyl-4H-pyran-4-yl]acetic acid |
| SMILES | CC=C1[C@H](CC(=O)O)C(C(=O)OC)=CO[C@H]1O |
| InChI | InChI=1S/C11H14O6/c1-3-6-7(4-9(12)13)8(10(14)16-2)5-17-11(6)15/h3,5,7,11,15H,4H2,1-2H3,(H,12,13)/t7-,11+/m0/s1 |
| InChIKey | FIKLMMHLPVXWJN-WRWORJQWSA-N |
| XLogP | 0.43 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|