About [(2S,3R)-2-acetamido-3-hydroxybutyl] 2-(trimethylazaniumyl)ethyl phosphate
[(2S,3R)-2-acetamido-3-hydroxybutyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 152743437) has the molecular formula C11H25N2O6P
and a molecular weight of 312.30 g/mol. Its IUPAC name is [(2S,3R)-2-acetamido-3-hydroxybutyl] 2-(trimethylazaniumyl)ethyl phosphate.
Molecular Properties
| Compound Name | [(2S,3R)-2-acetamido-3-hydroxybutyl] 2-(trimethylazaniumyl)ethyl phosphate |
| PubChem CID | 152743437 |
| Molecular Formula | C11H25N2O6P |
| Molecular Weight | 312.30 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | [(2S,3R)-2-acetamido-3-hydroxybutyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CC(=O)N[C@@H](COP(=O)([O-])OCC[N+](C)(C)C)[C@@H](C)O |
| InChI | InChI=1S/C11H25N2O6P/c1-9(14)11(12-10(2)15)8-19-20(16,17)18-7-6-13(3,4)5/h9,11,14H,6-8H2,1-5H3,(H-,12,15,16,17)/t9-,11+/m1/s1 |
| InChIKey | VKNGBVYUXUSPPN-KOLCDFICSA-N |
| XLogP | -0.92 |
| TPSA | 107.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.30 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [(2S,3R)-2-acetamido-3-hydroxybutyl] 2-(trimethylazaniumyl)ethyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,3R)-2-acetamido-3-hydroxybutyl] 2-(trimethylazaniumyl)ethyl phosphate?
The IUPAC name of [(2S,3R)-2-acetamido-3-hydroxybutyl] 2-(trimethylazaniumyl)ethyl phosphate (CID 152743437) is [(2S,3R)-2-acetamido-3-hydroxybutyl] 2-(trimethylazaniumyl)ethyl phosphate.
What is the SMILES notation for [(2S,3R)-2-acetamido-3-hydroxybutyl] 2-(trimethylazaniumyl)ethyl phosphate?
The canonical SMILES for [(2S,3R)-2-acetamido-3-hydroxybutyl] 2-(trimethylazaniumyl)ethyl phosphate is CC(=O)N[C@@H](COP(=O)([O-])OCC[N+](C)(C)C)[C@@H](C)O.
What is the InChIKey of [(2S,3R)-2-acetamido-3-hydroxybutyl] 2-(trimethylazaniumyl)ethyl phosphate?
The InChIKey is VKNGBVYUXUSPPN-KOLCDFICSA-N. The full InChI is InChI=1S/C11H25N2O6P/c1-9(14)11(12-10(2)15)8-19-20(16,17)18-7-6-13(3,4)5/h9,11,14H,6-8H2,1-5H3,(H-,12,15,16,17)/t9-,11+/m1/s1.
What are the key properties of [(2S,3R)-2-acetamido-3-hydroxybutyl] 2-(trimethylazaniumyl)ethyl phosphate?
[(2S,3R)-2-acetamido-3-hydroxybutyl] 2-(trimethylazaniumyl)ethyl phosphate has a molecular weight of 312.30 g/mol, XLogP of -0.92, 9 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,3R)-2-acetamido-3-hydroxybutyl] 2-(trimethylazaniumyl)ethyl phosphate is sourced from PubChem (CID 152743437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).