About 1-oct-1-ynyladamantane
1-oct-1-ynyladamantane (PubChem CID 15274347) has the molecular formula C18H28
and a molecular weight of 244.42 g/mol. Its IUPAC name is 1-oct-1-ynyladamantane.
Molecular Properties
| Compound Name | 1-oct-1-ynyladamantane |
| PubChem CID | 15274347 |
| Molecular Formula | C18H28 |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | 1-oct-1-ynyladamantane |
| SMILES | CCCCCCC#CC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C18H28/c1-2-3-4-5-6-7-8-18-12-15-9-16(13-18)11-17(10-15)14-18/h15-17H,2-6,9-14H2,1H3 |
| InChIKey | NGWWEBWKNOBDDQ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-oct-1-ynyladamantane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-oct-1-ynyladamantane?
The IUPAC name of 1-oct-1-ynyladamantane (CID 15274347) is 1-oct-1-ynyladamantane.
What is the SMILES notation for 1-oct-1-ynyladamantane?
The canonical SMILES for 1-oct-1-ynyladamantane is CCCCCCC#CC12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 1-oct-1-ynyladamantane?
The InChIKey is NGWWEBWKNOBDDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28/c1-2-3-4-5-6-7-8-18-12-15-9-16(13-18)11-17(10-15)14-18/h15-17H,2-6,9-14H2,1H3.
What are the key properties of 1-oct-1-ynyladamantane?
1-oct-1-ynyladamantane has a molecular weight of 244.42 g/mol, XLogP of 5.18, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-oct-1-ynyladamantane is sourced from PubChem (CID 15274347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).